C21H23NO2 — CID 70417735
(1S,9S)-9-phenyl-11-prop-2-enyl-11-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-5,6-diol (PubChem CID 70417735) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1S,9S)-9-phenyl-11-prop-2-enyl-11-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-5,6-diol.
| Compound Name | (1S,9S)-9-phenyl-11-prop-2-enyl-11-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-5,6-diol |
|---|---|
| PubChem CID | 70417735 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (1S,9S)-9-phenyl-11-prop-2-enyl-11-azatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-5,6-diol |
| SMILES | C=CCN1C[C@H]2CCc3c(O)c(O)cc(c32)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO2/c1-2-10-22-12-15-8-9-16-20(15)17(11-19(23)21(16)24)18(13-22)14-6-4-3-5-7-14/h2-7,11,15,18,23-24H,1,8-10,12-13H2/t15-,18+/m1/s1 |
| InChIKey | NWZGBGAPELRKAW-QAPCUYQASA-N |
| XLogP | 3.76 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|