C20H23N — CID 122547642
7-methyl-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 122547642) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 7-methyl-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-methyl-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 122547642 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 7-methyl-5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | C=CCN1CCc2ccc(C)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23N/c1-3-12-21-13-11-18-10-9-16(2)14-19(18)20(15-21)17-7-5-4-6-8-17/h3-10,14,20H,1,11-13,15H2,2H3 |
| InChIKey | ASLBLMFJJKSEDS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|