C20H22BrN — CID 122547643
5-(4-bromophenyl)-7-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 122547643) has the molecular formula C20H22BrN and a molecular weight of 356.31 g/mol. Its IUPAC name is 5-(4-bromophenyl)-7-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 5-(4-bromophenyl)-7-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 122547643 |
| Molecular Formula | C20H22BrN |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-(4-bromophenyl)-7-methyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | C=CCN1CCc2ccc(C)cc2C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H22BrN/c1-3-11-22-12-10-17-5-4-15(2)13-19(17)20(14-22)16-6-8-18(21)9-7-16/h3-9,13,20H,1,10-12,14H2,2H3 |
| InChIKey | FBLNKZAHCJUJMY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|