C33H32F2N4O6 — CID 70418279
2-amino-5-[1-[1-[bis(4-fluorophenyl)methyl]azetidin-3-yl]propan-2-yloxycarbonyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70418279) has the molecular formula C33H32F2N4O6 and a molecular weight of 618.64 g/mol. Its IUPAC name is 2-amino-5-[1-[1-[bis(4-fluorophenyl)methyl]azetidin-3-yl]propan-2-yloxycarbonyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 2-amino-5-[1-[1-[bis(4-fluorophenyl)methyl]azetidin-3-yl]propan-2-yloxycarbonyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70418279 |
| Molecular Formula | C33H32F2N4O6 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 2-amino-5-[1-[1-[bis(4-fluorophenyl)methyl]azetidin-3-yl]propan-2-yloxycarbonyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)OC(C)CC2CN(C(c3ccc(F)cc3)c3ccc(F)cc3)C2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(N)N1 |
| InChI | InChI=1S/C33H32F2N4O6/c1-18(14-20-16-38(17-20)30(21-6-10-24(34)11-7-21)22-8-12-25(35)13-9-22)45-33(42)27-19(2)37-31(36)29(32(40)41)28(27)23-4-3-5-26(15-23)39(43)44/h3-13,15,18,20,28,30,37H,14,16-17,36H2,1-2H3,(H,40,41) |
| InChIKey | WGMDYCGSQVTPQH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|