About ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate
ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate (PubChem CID 70419125) has the molecular formula C22H35BrO5
and a molecular weight of 459.42 g/mol. Its IUPAC name is ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate.
Molecular Properties
| Compound Name | ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate |
| PubChem CID | 70419125 |
| Molecular Formula | C22H35BrO5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate |
| SMILES | CCCC1(OCCCCCBr)CC(OCCCC(=O)OCC)=CC=C1C(C)=O |
| InChI | InChI=1S/C22H35BrO5/c1-4-13-22(28-16-8-6-7-14-23)17-19(11-12-20(22)18(3)24)27-15-9-10-21(25)26-5-2/h11-12H,4-10,13-17H2,1-3H3 |
| InChIKey | QCXGTGJXXMVJCY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate?
The IUPAC name of ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate (CID 70419125) is ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate.
What is the SMILES notation for ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate?
The canonical SMILES for ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate is CCCC1(OCCCCCBr)CC(OCCCC(=O)OCC)=CC=C1C(C)=O.
What is the InChIKey of ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate?
The InChIKey is QCXGTGJXXMVJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35BrO5/c1-4-13-22(28-16-8-6-7-14-23)17-19(11-12-20(22)18(3)24)27-15-9-10-21(25)26-5-2/h11-12H,4-10,13-17H2,1-3H3.
What are the key properties of ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate?
ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate has a molecular weight of 459.42 g/mol, XLogP of 5.27, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoate is sourced from PubChem (CID 70419125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).