C20H31BrO5 — CID 21287014
4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoic acid (PubChem CID 21287014) has the molecular formula C20H31BrO5 and a molecular weight of 431.37 g/mol. Its IUPAC name is 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoic acid.
| Compound Name | 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 21287014 |
| Molecular Formula | C20H31BrO5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[4-acetyl-5-(5-bromopentoxy)-5-propylcyclohexa-1,3-dien-1-yl]oxybutanoic acid |
| SMILES | CCCC1(OCCCCCBr)CC(OCCCC(=O)O)=CC=C1C(C)=O |
| InChI | InChI=1S/C20H31BrO5/c1-3-11-20(26-14-6-4-5-12-21)15-17(9-10-18(20)16(2)22)25-13-7-8-19(23)24/h9-10H,3-8,11-15H2,1-2H3,(H,23,24) |
| InChIKey | PVBXHVXZKIZGKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|