C20H22O10 — CID 70420422
4-[2-(4,4-dicarboxy-2-methylcyclohexa-1,5-dien-1-yl)oxyethoxy]-5-methylcyclohexa-2,4-diene-1,1-dicarboxylic acid (PubChem CID 70420422) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is 4-[2-(4,4-dicarboxy-2-methylcyclohexa-1,5-dien-1-yl)oxyethoxy]-5-methylcyclohexa-2,4-diene-1,1-dicarboxylic acid.
| Compound Name | 4-[2-(4,4-dicarboxy-2-methylcyclohexa-1,5-dien-1-yl)oxyethoxy]-5-methylcyclohexa-2,4-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 70420422 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 4-[2-(4,4-dicarboxy-2-methylcyclohexa-1,5-dien-1-yl)oxyethoxy]-5-methylcyclohexa-2,4-diene-1,1-dicarboxylic acid |
| SMILES | CC1=C(OCCOC2=C(C)CC(C(=O)O)(C(=O)O)C=C2)C=CC(C(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C20H22O10/c1-11-9-19(15(21)22,16(23)24)5-3-13(11)29-7-8-30-14-4-6-20(17(25)26,18(27)28)10-12(14)2/h3-6H,7-10H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | CCQWZZNWRPPUGI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|