C16H14O9 — CID 138471628
5-(5,5-dicarboxycyclohexa-1,3-dien-1-yl)oxycyclohexa-2,4-diene-1,1-dicarboxylic acid (PubChem CID 138471628) has the molecular formula C16H14O9 and a molecular weight of 350.28 g/mol. Its IUPAC name is 5-(5,5-dicarboxycyclohexa-1,3-dien-1-yl)oxycyclohexa-2,4-diene-1,1-dicarboxylic acid.
| Compound Name | 5-(5,5-dicarboxycyclohexa-1,3-dien-1-yl)oxycyclohexa-2,4-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 138471628 |
| Molecular Formula | C16H14O9 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 5-(5,5-dicarboxycyclohexa-1,3-dien-1-yl)oxycyclohexa-2,4-diene-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)C=CC=C(OC2=CC=CC(C(=O)O)(C(=O)O)C2)C1 |
| InChI | InChI=1S/C16H14O9/c17-11(18)15(12(19)20)5-1-3-9(7-15)25-10-4-2-6-16(8-10,13(21)22)14(23)24/h1-6H,7-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | POGOTYSSMDDYSC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|