C8H8O4 — CID 19754990
4-methylidenecyclopent-2-ene-1,1-dicarboxylic acid (PubChem CID 19754990) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-methylidenecyclopent-2-ene-1,1-dicarboxylic acid.
| Compound Name | 4-methylidenecyclopent-2-ene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 19754990 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 4-methylidenecyclopent-2-ene-1,1-dicarboxylic acid |
| SMILES | C=C1C=CC(C(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C8H8O4/c1-5-2-3-8(4-5,6(9)10)7(11)12/h2-3H,1,4H2,(H,9,10)(H,11,12) |
| InChIKey | WHNPTRYCHIWARF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|