C15H22N3O+ — CID 7042091
(2-ethoxyphenyl)methyl-(3-imidazol-1-ylpropyl)azanium (PubChem CID 7042091) has the molecular formula C15H22N3O+ and a molecular weight of 260.36 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl-(3-imidazol-1-ylpropyl)azanium.
| Compound Name | (2-ethoxyphenyl)methyl-(3-imidazol-1-ylpropyl)azanium |
|---|---|
| PubChem CID | 7042091 |
| Molecular Formula | C15H22N3O+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2-ethoxyphenyl)methyl-(3-imidazol-1-ylpropyl)azanium |
| SMILES | CCOc1ccccc1C[NH2+]CCCn1ccnc1 |
| InChI | InChI=1S/C15H21N3O/c1-2-19-15-7-4-3-6-14(15)12-16-8-5-10-18-11-9-17-13-18/h3-4,6-7,9,11,13,16H,2,5,8,10,12H2,1H3/p+1 |
| InChIKey | YCWSMAXQONOVIA-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 43.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|