C20H20O2S — CID 70421185
4-[1-(2-naphthalen-1-ylethenyl)thiophen-1-yl]butanoic acid (PubChem CID 70421185) has the molecular formula C20H20O2S and a molecular weight of 324.44 g/mol. Its IUPAC name is 4-[1-(2-naphthalen-1-ylethenyl)thiophen-1-yl]butanoic acid.
| Compound Name | 4-[1-(2-naphthalen-1-ylethenyl)thiophen-1-yl]butanoic acid |
|---|---|
| PubChem CID | 70421185 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[1-(2-naphthalen-1-ylethenyl)thiophen-1-yl]butanoic acid |
| SMILES | O=C(O)CCCS1(C=Cc2cccc3ccccc23)C=CC=C1 |
| InChI | InChI=1S/C20H20O2S/c21-20(22)11-6-15-23(13-3-4-14-23)16-12-18-9-5-8-17-7-1-2-10-19(17)18/h1-5,7-10,12-14,16H,6,11,15H2,(H,21,22) |
| InChIKey | IURMBHXJEIQHMV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |