C31H52O6Si — CID 70424238
(3R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxoheptanoic acid (PubChem CID 70424238) has the molecular formula C31H52O6Si and a molecular weight of 548.84 g/mol. Its IUPAC name is (3R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxoheptanoic acid.
| Compound Name | (3R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 70424238 |
| Molecular Formula | C31H52O6Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | (3R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-oxoheptanoic acid |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CCC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C(=O)O)[C@H]21 |
| InChI | InChI=1S/C31H52O6Si/c1-11-20(3)30(35)36-27-17-19(2)16-23-13-12-21(4)25(28(23)27)15-14-24(32)18-26(22(5)29(33)34)37-38(9,10)31(6,7)8/h12-13,16,19-22,25-28H,11,14-15,17-18H2,1-10H3,(H,33,34)/t19-,20-,21-,22?,25-,26+,27-,28-/m0/s1 |
| InChIKey | BBDUWVIQVKMSJW-XMADCVEBSA-N |
| XLogP | 7.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|