C31H32Cl2N2O5 — CID 70427152
3-[1-[3-(2,6-dichlorophenoxy)propyl]piperidin-3-yl]-2,2-diphenylpropanenitrile;oxalic acid (PubChem CID 70427152) has the molecular formula C31H32Cl2N2O5 and a molecular weight of 583.51 g/mol. Its IUPAC name is 3-[1-[3-(2,6-dichlorophenoxy)propyl]piperidin-3-yl]-2,2-diphenylpropanenitrile;oxalic acid.
| Compound Name | 3-[1-[3-(2,6-dichlorophenoxy)propyl]piperidin-3-yl]-2,2-diphenylpropanenitrile;oxalic acid |
|---|---|
| PubChem CID | 70427152 |
| Molecular Formula | C31H32Cl2N2O5 |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 3-[1-[3-(2,6-dichlorophenoxy)propyl]piperidin-3-yl]-2,2-diphenylpropanenitrile;oxalic acid |
| SMILES | N#CC(CC1CCCN(CCCOc2c(Cl)cccc2Cl)C1)(c1ccccc1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H30Cl2N2O.C2H2O4/c30-26-15-7-16-27(31)28(26)34-19-9-18-33-17-8-10-23(21-33)20-29(22-32,24-11-3-1-4-12-24)25-13-5-2-6-14-25;3-1(4)2(5)6/h1-7,11-16,23H,8-10,17-21H2;(H,3,4)(H,5,6) |
| InChIKey | DJSFXIINASSYDZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|