C23H20Cl2N2O4 — CID 70429921
2-[6-(3,4-dichlorophenoxy)-1,3-benzoxazol-2-yl]benzoic acid;propan-2-amine (PubChem CID 70429921) has the molecular formula C23H20Cl2N2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is 2-[6-(3,4-dichlorophenoxy)-1,3-benzoxazol-2-yl]benzoic acid;propan-2-amine.
| Compound Name | 2-[6-(3,4-dichlorophenoxy)-1,3-benzoxazol-2-yl]benzoic acid;propan-2-amine |
|---|---|
| PubChem CID | 70429921 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2-[6-(3,4-dichlorophenoxy)-1,3-benzoxazol-2-yl]benzoic acid;propan-2-amine |
| SMILES | CC(C)N.O=C(O)c1ccccc1-c1nc2ccc(Oc3ccc(Cl)c(Cl)c3)cc2o1 |
| InChI | InChI=1S/C20H11Cl2NO4.C3H9N/c21-15-7-5-11(9-16(15)22)26-12-6-8-17-18(10-12)27-19(23-17)13-3-1-2-4-14(13)20(24)25;1-3(2)4/h1-10H,(H,24,25);3H,4H2,1-2H3 |
| InChIKey | VSARUKYEFXJDEK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |