C31H27F3N2OSSn — CID 70432280
3-butyl-7-(trifluoromethyl)-2-triphenylstannylsulfanylquinazolin-4-one (PubChem CID 70432280) has the molecular formula C31H27F3N2OSSn and a molecular weight of 651.34 g/mol. Its IUPAC name is 3-butyl-7-(trifluoromethyl)-2-triphenylstannylsulfanylquinazolin-4-one.
| Compound Name | 3-butyl-7-(trifluoromethyl)-2-triphenylstannylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 70432280 |
| Molecular Formula | C31H27F3N2OSSn |
| Molecular Weight | 651.34 g/mol |
| Exact Mass | 652.08 |
| IUPAC Name | 3-butyl-7-(trifluoromethyl)-2-triphenylstannylsulfanylquinazolin-4-one |
| SMILES | CCCCn1c(S[Sn](c2ccccc2)(c2ccccc2)c2ccccc2)nc2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C13H13F3N2OS.3C6H5.Sn/c1-2-3-6-18-11(19)9-5-4-8(13(14,15)16)7-10(9)17-12(18)20;3*1-2-4-6-5-3-1;/h4-5,7H,2-3,6H2,1H3,(H,17,20);3*1-5H;/q;;;;+1/p-1 |
| InChIKey | CRLHADOIFBRIIZ-UHFFFAOYSA-M |
| XLogP | 5.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |