About 3-butan-2-ylthiophene;3-(chloromethyl)thiophene
3-butan-2-ylthiophene;3-(chloromethyl)thiophene (PubChem CID 70438640) has the molecular formula C13H17ClS2
and a molecular weight of 272.87 g/mol. Its IUPAC name is 3-butan-2-ylthiophene;3-(chloromethyl)thiophene.
Molecular Properties
| Compound Name | 3-butan-2-ylthiophene;3-(chloromethyl)thiophene |
| PubChem CID | 70438640 |
| Molecular Formula | C13H17ClS2 |
| Molecular Weight | 272.87 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-butan-2-ylthiophene;3-(chloromethyl)thiophene |
| SMILES | CCC(C)c1ccsc1.ClCc1ccsc1 |
| InChI | InChI=1S/C8H12S.C5H5ClS/c1-3-7(2)8-4-5-9-6-8;6-3-5-1-2-7-4-5/h4-7H,3H2,1-2H3;1-2,4H,3H2 |
| InChIKey | QALRIIHUGFDWBU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-ylthiophene;3-(chloromethyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-ylthiophene;3-(chloromethyl)thiophene?
The IUPAC name of 3-butan-2-ylthiophene;3-(chloromethyl)thiophene (CID 70438640) is 3-butan-2-ylthiophene;3-(chloromethyl)thiophene.
What is the SMILES notation for 3-butan-2-ylthiophene;3-(chloromethyl)thiophene?
The canonical SMILES for 3-butan-2-ylthiophene;3-(chloromethyl)thiophene is CCC(C)c1ccsc1.ClCc1ccsc1.
What is the InChIKey of 3-butan-2-ylthiophene;3-(chloromethyl)thiophene?
The InChIKey is QALRIIHUGFDWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S.C5H5ClS/c1-3-7(2)8-4-5-9-6-8;6-3-5-1-2-7-4-5/h4-7H,3H2,1-2H3;1-2,4H,3H2.
What are the key properties of 3-butan-2-ylthiophene;3-(chloromethyl)thiophene?
3-butan-2-ylthiophene;3-(chloromethyl)thiophene has a molecular weight of 272.87 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-ylthiophene;3-(chloromethyl)thiophene is sourced from PubChem (CID 70438640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).