C25H28N2O6S — CID 70443369
(2S)-1-[(2S)-2-[(1-carboxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 70443369) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(1-carboxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[(1-carboxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70443369 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (2S)-1-[(2S)-2-[(1-carboxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](NC(CCc1ccccc1)C(=O)C(=O)O)C(=O)N1CC(Sc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C25H28N2O6S/c1-16(26-20(22(28)25(32)33)13-12-17-8-4-2-5-9-17)23(29)27-15-19(14-21(27)24(30)31)34-18-10-6-3-7-11-18/h2-11,16,19-21,26H,12-15H2,1H3,(H,30,31)(H,32,33)/t16-,19?,20?,21-/m0/s1 |
| InChIKey | GCQMOFPTFCXFPU-AOUGCYQESA-N |
| XLogP | 2.47 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|