C22H23NO5S2 — CID 85047939
1-(3-benzoylsulfinyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 85047939) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-(3-benzoylsulfinyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(3-benzoylsulfinyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 85047939 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-(3-benzoylsulfinyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | CC(CS(=O)C(=O)c1ccccc1)C(=O)N1CC(Sc2ccccc2)CC1C(=O)O |
| InChI | InChI=1S/C22H23NO5S2/c1-15(14-30(28)22(27)16-8-4-2-5-9-16)20(24)23-13-18(12-19(23)21(25)26)29-17-10-6-3-7-11-17/h2-11,15,18-19H,12-14H2,1H3,(H,25,26) |
| InChIKey | HCPQVVBXSZHBSL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|