C44H44CaN2O8S4 — CID 72727413
calcium bis(1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylate) (PubChem CID 72727413) has the molecular formula C44H44CaN2O8S4 and a molecular weight of 897.19 g/mol. Its IUPAC name is calcium bis(1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylate).
| Compound Name | calcium bis(1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylate) |
|---|---|
| PubChem CID | 72727413 |
| Molecular Formula | C44H44CaN2O8S4 |
| Molecular Weight | 897.19 g/mol |
| Exact Mass | 896.16 |
| IUPAC Name | calcium bis(1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylate) |
| SMILES | CC(CSC(=O)c1ccccc1)C(=O)N1CC(Sc2ccccc2)CC1C(=O)[O-].CC(CSC(=O)c1ccccc1)C(=O)N1CC(Sc2ccccc2)CC1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H23NO4S2.Ca/c2*1-15(14-28-22(27)16-8-4-2-5-9-16)20(24)23-13-18(12-19(23)21(25)26)29-17-10-6-3-7-11-17;/h2*2-11,15,18-19H,12-14H2,1H3,(H,25,26);/q;;+2/p-2 |
| InChIKey | NSYUKKYYVFVMST-UHFFFAOYSA-L |
| XLogP | 5.03 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|