C23H25NO5S2 — CID 22819397
(2S,4S)-1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-(4-methoxyphenyl)sulfanylpyrrolidine-2-carboxylic acid (PubChem CID 22819397) has the molecular formula C23H25NO5S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S,4S)-1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-(4-methoxyphenyl)sulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-(4-methoxyphenyl)sulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22819397 |
| Molecular Formula | C23H25NO5S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (2S,4S)-1-(3-benzoylsulfanyl-2-methylpropanoyl)-4-(4-methoxyphenyl)sulfanylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(S[C@H]2C[C@@H](C(=O)O)N(C(=O)C(C)CSC(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H25NO5S2/c1-15(14-30-23(28)16-6-4-3-5-7-16)21(25)24-13-19(12-20(24)22(26)27)31-18-10-8-17(29-2)9-11-18/h3-11,15,19-20H,12-14H2,1-2H3,(H,26,27)/t15?,19-,20-/m0/s1 |
| InChIKey | BMFDYUKFGSLZQZ-FIRGRZAASA-N |
| XLogP | 4.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|