C18H23NO5S — CID 70550161
(2S)-1-(5-methoxy-4-methyl-5-oxopentanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 70550161) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S)-1-(5-methoxy-4-methyl-5-oxopentanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(5-methoxy-4-methyl-5-oxopentanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70550161 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2S)-1-(5-methoxy-4-methyl-5-oxopentanoyl)-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)C(C)CCC(=O)N1CC(Sc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H23NO5S/c1-12(18(23)24-2)8-9-16(20)19-11-14(10-15(19)17(21)22)25-13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3,(H,21,22)/t12?,14?,15-/m0/s1 |
| InChIKey | UXOAFCIYHAKJIN-ZALBZXLWSA-N |
| XLogP | 2.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |