C25H27NO6S — CID 54157914
(2S,4S)-1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-4-[4-(2-methoxyethenyl)phenoxy]pyrrolidine-2-carboxylic acid (PubChem CID 54157914) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-4-[4-(2-methoxyethenyl)phenoxy]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-4-[4-(2-methoxyethenyl)phenoxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54157914 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (2S,4S)-1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-4-[4-(2-methoxyethenyl)phenoxy]pyrrolidine-2-carboxylic acid |
| SMILES | COC=Cc1ccc(O[C@H]2C[C@@H](C(=O)O)N(C(=O)[C@H](C)CSC(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H27NO6S/c1-17(16-33-25(30)19-6-4-3-5-7-19)23(27)26-15-21(14-22(26)24(28)29)32-20-10-8-18(9-11-20)12-13-31-2/h3-13,17,21-22H,14-16H2,1-2H3,(H,28,29)/t17-,21+,22+/m1/s1 |
| InChIKey | OMJMEPGFBAAESF-WTNAPCKOSA-N |
| XLogP | 3.95 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|