C22H35ClF3N — CID 70446496
diethyl-heptyl-[4-[4-(trifluoromethyl)phenyl]but-2-enyl]azanium chloride (PubChem CID 70446496) has the molecular formula C22H35ClF3N and a molecular weight of 405.98 g/mol. Its IUPAC name is diethyl-heptyl-[4-[4-(trifluoromethyl)phenyl]but-2-enyl]azanium chloride.
| Compound Name | diethyl-heptyl-[4-[4-(trifluoromethyl)phenyl]but-2-enyl]azanium chloride |
|---|---|
| PubChem CID | 70446496 |
| Molecular Formula | C22H35ClF3N |
| Molecular Weight | 405.98 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | diethyl-heptyl-[4-[4-(trifluoromethyl)phenyl]but-2-enyl]azanium chloride |
| SMILES | CCCCCCC[N+](CC)(CC)CC=CCc1ccc(C(F)(F)F)cc1.[Cl-] |
| InChI | InChI=1S/C22H35F3N.ClH/c1-4-7-8-9-11-18-26(5-2,6-3)19-12-10-13-20-14-16-21(17-15-20)22(23,24)25;/h10,12,14-17H,4-9,11,13,18-19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LJQYDGQNXTZQGU-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|