About decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene
decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene (PubChem CID 157091649) has the molecular formula C23H38F3N
and a molecular weight of 385.56 g/mol. Its IUPAC name is decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene |
| PubChem CID | 157091649 |
| Molecular Formula | C23H38F3N |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene |
| SMILES | CCCC=CCc1ccc(C(F)(F)F)cc1.CCCCCCCCCCN |
| InChI | InChI=1S/C13H15F3.C10H23N/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14,15)16;1-2-3-4-5-6-7-8-9-10-11/h4-5,7-10H,2-3,6H2,1H3;2-11H2,1H3 |
| InChIKey | AESSPEQTFSNLMG-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene?
The IUPAC name of decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene (CID 157091649) is decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene.
What is the SMILES notation for decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene?
The canonical SMILES for decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene is CCCC=CCc1ccc(C(F)(F)F)cc1.CCCCCCCCCCN.
What is the InChIKey of decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene?
The InChIKey is AESSPEQTFSNLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3.C10H23N/c1-2-3-4-5-6-11-7-9-12(10-8-11)13(14,15)16;1-2-3-4-5-6-7-8-9-10-11/h4-5,7-10H,2-3,6H2,1H3;2-11H2,1H3.
What are the key properties of decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene?
decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene has a molecular weight of 385.56 g/mol, XLogP of 7.69, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;1-hex-2-enyl-4-(trifluoromethyl)benzene is sourced from PubChem (CID 157091649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).