C22H30N2O5 — CID 70447594
but-2-enedioic acid;4-methyl-N-(1-methyl-1-azaspiro[4.5]decan-4-yl)benzamide (PubChem CID 70447594) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is but-2-enedioic acid;4-methyl-N-(1-methyl-1-azaspiro[4.5]decan-4-yl)benzamide.
| Compound Name | but-2-enedioic acid;4-methyl-N-(1-methyl-1-azaspiro[4.5]decan-4-yl)benzamide |
|---|---|
| PubChem CID | 70447594 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | but-2-enedioic acid;4-methyl-N-(1-methyl-1-azaspiro[4.5]decan-4-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C)C23CCCCC3)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H26N2O.C4H4O4/c1-14-6-8-15(9-7-14)17(21)19-16-10-13-20(2)18(16)11-4-3-5-12-18;5-3(6)1-2-4(7)8/h6-9,16H,3-5,10-13H2,1-2H3,(H,19,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | CCDDMPKZGQRPDC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|