C11H17F3N2O4 — CID 7044776
methyl (2R)-2-acetamido-3,3,3-trifluoro-2-[[(2R)-oxolan-2-yl]methylamino]propanoate (PubChem CID 7044776) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3,3,3-trifluoro-2-[[(2R)-oxolan-2-yl]methylamino]propanoate.
| Compound Name | methyl (2R)-2-acetamido-3,3,3-trifluoro-2-[[(2R)-oxolan-2-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 7044776 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl (2R)-2-acetamido-3,3,3-trifluoro-2-[[(2R)-oxolan-2-yl]methylamino]propanoate |
| SMILES | COC(=O)[C@@](NC[C@H]1CCCO1)(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O4/c1-7(17)16-10(9(18)19-2,11(12,13)14)15-6-8-4-3-5-20-8/h8,15H,3-6H2,1-2H3,(H,16,17)/t8-,10-/m1/s1 |
| InChIKey | AEVAGMQDQDFUJV-PSASIEDQSA-N |
| XLogP | 0.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|