C20H32O5 — CID 70449116
(2R,3R,4R)-4-hydroxy-2-[4-(2-hydroxyethoxy)but-2-ynyl]-3-[(E)-4-hydroxy-4-methyloct-1-enyl]cyclopentan-1-one (PubChem CID 70449116) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-2-[4-(2-hydroxyethoxy)but-2-ynyl]-3-[(E)-4-hydroxy-4-methyloct-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-2-[4-(2-hydroxyethoxy)but-2-ynyl]-3-[(E)-4-hydroxy-4-methyloct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70449116 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-2-[4-(2-hydroxyethoxy)but-2-ynyl]-3-[(E)-4-hydroxy-4-methyloct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC(C)(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CC#CCOCCO |
| InChI | InChI=1S/C20H32O5/c1-3-4-10-20(2,24)11-7-9-17-16(18(22)15-19(17)23)8-5-6-13-25-14-12-21/h7,9,16-17,19,21,23-24H,3-4,8,10-15H2,1-2H3/b9-7+/t16-,17-,19-,20?/m1/s1 |
| InChIKey | UZECWTJGRABCJK-FUIXYOSWSA-N |
| XLogP | 1.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|