C21H34O6 — CID 70470305
(2R,3R,4R)-4-hydroxy-3-[(E)-4-hydroxy-4-methyloct-1-enyl]-2-[(Z)-4-(3-hydroxy-2-oxopropoxy)but-1-enyl]cyclopentan-1-one (PubChem CID 70470305) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-3-[(E)-4-hydroxy-4-methyloct-1-enyl]-2-[(Z)-4-(3-hydroxy-2-oxopropoxy)but-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-3-[(E)-4-hydroxy-4-methyloct-1-enyl]-2-[(Z)-4-(3-hydroxy-2-oxopropoxy)but-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70470305 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-3-[(E)-4-hydroxy-4-methyloct-1-enyl]-2-[(Z)-4-(3-hydroxy-2-oxopropoxy)but-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC(C)(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1/C=C\CCOCC(=O)CO |
| InChI | InChI=1S/C21H34O6/c1-3-4-10-21(2,26)11-7-9-18-17(19(24)13-20(18)25)8-5-6-12-27-15-16(23)14-22/h5,7-9,17-18,20,22,25-26H,3-4,6,10-15H2,1-2H3/b8-5-,9-7+/t17-,18-,20-,21?/m1/s1 |
| InChIKey | OOGRSESJWYFZPQ-RGHVZJMFSA-N |
| XLogP | 1.96 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|