C15H18N3O5+ — CID 7044923
(1S,5R)-3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]nonan-7-one (PubChem CID 7044923) has the molecular formula C15H18N3O5+ and a molecular weight of 320.32 g/mol. Its IUPAC name is (1S,5R)-3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,5R)-3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 7044923 |
| Molecular Formula | C15H18N3O5+ |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (1S,5R)-3-benzyl-1,5-dinitro-3-azoniabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1C[C@]2([N+](=O)[O-])C[NH+](Cc3ccccc3)C[C@]([N+](=O)[O-])(C1)C2 |
| InChI | InChI=1S/C15H17N3O5/c19-13-6-14(17(20)21)9-15(7-13,18(22)23)11-16(10-14)8-12-4-2-1-3-5-12/h1-5H,6-11H2/p+1/t14-,15+ |
| InChIKey | DSDQBMZGTLAVMG-GASCZTMLSA-O |
| XLogP | -0.13 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|