C14H11N3OS — CID 704494
4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenol (PubChem CID 704494) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenol.
| Compound Name | 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenol |
|---|---|
| PubChem CID | 704494 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenol |
| SMILES | Oc1ccc(Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C14H11N3OS/c18-12-3-1-11(2-4-12)16-14-17-13(9-19-14)10-5-7-15-8-6-10/h1-9,18H,(H,16,17) |
| InChIKey | CXBUDGYAYBLEHP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|