C25H38N2O3 — CID 70450186
2-cyano-2-[8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid;octane (PubChem CID 70450186) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is 2-cyano-2-[8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid;octane.
| Compound Name | 2-cyano-2-[8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid;octane |
|---|---|
| PubChem CID | 70450186 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 2-cyano-2-[8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid;octane |
| SMILES | CCCCCCCC.COc1ccc(N2C3CCC2CC(C(C#N)C(=O)O)C3)cc1 |
| InChI | InChI=1S/C17H20N2O3.C8H18/c1-22-15-6-4-12(5-7-15)19-13-2-3-14(19)9-11(8-13)16(10-18)17(20)21;1-3-5-7-8-6-4-2/h4-7,11,13-14,16H,2-3,8-9H2,1H3,(H,20,21);3-8H2,1-2H3 |
| InChIKey | DYUOKHOOPJLXGL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|