C21H28N2O5 — CID 70419860
ethyl 2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetate (PubChem CID 70419860) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethyl 2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetate.
| Compound Name | ethyl 2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetate |
|---|---|
| PubChem CID | 70419860 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl 2-cyano-2-[8-(3,4,5-trimethoxyphenyl)-8-azabicyclo[3.2.1]octan-3-yl]acetate |
| SMILES | CCOC(=O)C(C#N)C1CC2CCC(C1)N2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H28N2O5/c1-5-28-21(24)17(12-22)13-8-14-6-7-15(9-13)23(14)16-10-18(25-2)20(27-4)19(11-16)26-3/h10-11,13-15,17H,5-9H2,1-4H3 |
| InChIKey | DJTBWKFUMNPSLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|