C19H22N2O4S — CID 70450776
methyl 5-(1-prop-2-enylpyrrol-2-yl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 70450776) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is methyl 5-(1-prop-2-enylpyrrol-2-yl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | methyl 5-(1-prop-2-enylpyrrol-2-yl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 70450776 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | methyl 5-(1-prop-2-enylpyrrol-2-yl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | C=CCn1cccc1-c1c(S(=O)(=O)CC=C)cc2n1CCC2C(=O)OC |
| InChI | InChI=1S/C19H22N2O4S/c1-4-9-20-10-6-7-15(20)18-17(26(23,24)12-5-2)13-16-14(19(22)25-3)8-11-21(16)18/h4-7,10,13-14H,1-2,8-9,11-12H2,3H3 |
| InChIKey | HCMUTDJKPHFFKO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|