C18H24N2O2 — CID 141208309
methyl 2-(2,3-dihydro-1H-indol-2-yl)-1-prop-2-enylpiperidine-3-carboxylate (PubChem CID 141208309) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-indol-2-yl)-1-prop-2-enylpiperidine-3-carboxylate.
| Compound Name | methyl 2-(2,3-dihydro-1H-indol-2-yl)-1-prop-2-enylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 141208309 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-indol-2-yl)-1-prop-2-enylpiperidine-3-carboxylate |
| SMILES | C=CCN1CCCC(C(=O)OC)C1C1Cc2ccccc2N1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-10-20-11-6-8-14(18(21)22-2)17(20)16-12-13-7-4-5-9-15(13)19-16/h3-5,7,9,14,16-17,19H,1,6,8,10-12H2,2H3 |
| InChIKey | USBRBHDQJBQQOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|