C18H22O4 — CID 10733140
dimethyl (2S,3R,4S)-4-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene-2,3-dicarboxylate (PubChem CID 10733140) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is dimethyl (2S,3R,4S)-4-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3R,4S)-4-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10733140 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | dimethyl (2S,3R,4S)-4-methyl-4-prop-2-enyl-2,3-dihydro-1H-naphthalene-2,3-dicarboxylate |
| SMILES | C=CC[C@]1(C)c2ccccc2C[C@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H22O4/c1-5-10-18(2)14-9-7-6-8-12(14)11-13(16(19)21-3)15(18)17(20)22-4/h5-9,13,15H,1,10-11H2,2-4H3/t13-,15-,18+/m0/s1 |
| InChIKey | BXUUHIMVVUCYSD-DHSIGJKJSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|