C17H17NO4S2 — CID 70451010
methyl 6-prop-2-enylsulfinyl-5-(thiophene-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 70451010) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl 6-prop-2-enylsulfinyl-5-(thiophene-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | methyl 6-prop-2-enylsulfinyl-5-(thiophene-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 70451010 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | methyl 6-prop-2-enylsulfinyl-5-(thiophene-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | C=CCS(=O)c1cc2n(c1C(=O)c1cccs1)CCC2C(=O)OC |
| InChI | InChI=1S/C17H17NO4S2/c1-3-9-24(21)14-10-12-11(17(20)22-2)6-7-18(12)15(14)16(19)13-5-4-8-23-13/h3-5,8,10-11H,1,6-7,9H2,2H3 |
| InChIKey | NVLDKIUPVVUAEN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|