C26H37ClN4O3 — CID 70450921
3-N-[2-butoxy-3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 70450921) has the molecular formula C26H37ClN4O3 and a molecular weight of 489.06 g/mol. Its IUPAC name is 3-N-[2-butoxy-3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | 3-N-[2-butoxy-3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 70450921 |
| Molecular Formula | C26H37ClN4O3 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 3-N-[2-butoxy-3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CCCCOC(CNC(=O)C1C2C=CC(C2)C1C(N)=O)CN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H37ClN4O3/c1-2-3-14-34-20(16-29-26(33)24-19-9-8-18(15-19)23(24)25(28)32)17-30-10-12-31(13-11-30)22-7-5-4-6-21(22)27/h4-9,18-20,23-24H,2-3,10-17H2,1H3,(H2,28,32)(H,29,33) |
| InChIKey | GLMSFASDRAZAEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|