C16H15NO6S — CID 70451033
5-(furan-2-carbonyl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (PubChem CID 70451033) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 5-(furan-2-carbonyl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid.
| Compound Name | 5-(furan-2-carbonyl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 70451033 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-(furan-2-carbonyl)-6-prop-2-enylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| SMILES | C=CCS(=O)(=O)c1cc2n(c1C(=O)c1ccco1)CCC2C(=O)O |
| InChI | InChI=1S/C16H15NO6S/c1-2-8-24(21,22)13-9-11-10(16(19)20)5-6-17(11)14(13)15(18)12-4-3-7-23-12/h2-4,7,9-10H,1,5-6,8H2,(H,19,20) |
| InChIKey | XLJGZGJHNQZJGM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|