C19H21BrN2O2 — CID 70455535
[6-[1-(4-bromophenyl)-3-(dimethylamino)propyl]-2-pyridinyl] prop-2-enoate (PubChem CID 70455535) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is [6-[1-(4-bromophenyl)-3-(dimethylamino)propyl]-2-pyridinyl] prop-2-enoate.
| Compound Name | [6-[1-(4-bromophenyl)-3-(dimethylamino)propyl]-2-pyridinyl] prop-2-enoate |
|---|---|
| PubChem CID | 70455535 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [6-[1-(4-bromophenyl)-3-(dimethylamino)propyl]-2-pyridinyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(C(CCN(C)C)c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-4-19(23)24-18-7-5-6-17(21-18)16(12-13-22(2)3)14-8-10-15(20)11-9-14/h4-11,16H,1,12-13H2,2-3H3 |
| InChIKey | GKDUTJDKJXIONG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|