C22H23F2NO5 — CID 70455582
(Z)-but-2-enedioic acid;(3S,4R)-3-(2-fluorophenyl)-4-(3-fluorophenyl)-1-methylpiperidin-4-ol (PubChem CID 70455582) has the molecular formula C22H23F2NO5 and a molecular weight of 419.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(3S,4R)-3-(2-fluorophenyl)-4-(3-fluorophenyl)-1-methylpiperidin-4-ol.
| Compound Name | (Z)-but-2-enedioic acid;(3S,4R)-3-(2-fluorophenyl)-4-(3-fluorophenyl)-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 70455582 |
| Molecular Formula | C22H23F2NO5 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;(3S,4R)-3-(2-fluorophenyl)-4-(3-fluorophenyl)-1-methylpiperidin-4-ol |
| SMILES | CN1CC[C@](O)(c2cccc(F)c2)[C@@H](c2ccccc2F)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H19F2NO.C4H4O4/c1-21-10-9-18(22,13-5-4-6-14(19)11-13)16(12-21)15-7-2-3-8-17(15)20;5-3(6)1-2-4(7)8/h2-8,11,16,22H,9-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,18+;/m1./s1 |
| InChIKey | IAENNMYHNSSANT-KQYRMIMTSA-N |
| XLogP | 2.98 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|