C22H31N3O2S2 — CID 70458036
5-[1-hydroxy-5-(4-phenylpiperazin-1-yl)pentyl]-2-methylbenzenesulfonothioamide (PubChem CID 70458036) has the molecular formula C22H31N3O2S2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 5-[1-hydroxy-5-(4-phenylpiperazin-1-yl)pentyl]-2-methylbenzenesulfonothioamide.
| Compound Name | 5-[1-hydroxy-5-(4-phenylpiperazin-1-yl)pentyl]-2-methylbenzenesulfonothioamide |
|---|---|
| PubChem CID | 70458036 |
| Molecular Formula | C22H31N3O2S2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 5-[1-hydroxy-5-(4-phenylpiperazin-1-yl)pentyl]-2-methylbenzenesulfonothioamide |
| SMILES | Cc1ccc(C(O)CCCCN2CCN(c3ccccc3)CC2)cc1S(N)(=O)=S |
| InChI | InChI=1S/C22H31N3O2S2/c1-18-10-11-19(17-22(18)29(23,27)28)21(26)9-5-6-12-24-13-15-25(16-14-24)20-7-3-2-4-8-20/h2-4,7-8,10-11,17,21,26H,5-6,9,12-16H2,1H3,(H2,23,27,28) |
| InChIKey | ZMRCHCCXUROJCO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|