C13H23NO2 — CID 70461436
methyl (E)-2-amino-5-cyclopropyl-6,6-dimethylhept-3-enoate (PubChem CID 70461436) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is methyl (E)-2-amino-5-cyclopropyl-6,6-dimethylhept-3-enoate.
| Compound Name | methyl (E)-2-amino-5-cyclopropyl-6,6-dimethylhept-3-enoate |
|---|---|
| PubChem CID | 70461436 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | methyl (E)-2-amino-5-cyclopropyl-6,6-dimethylhept-3-enoate |
| SMILES | COC(=O)C(N)/C=C/C(C1CC1)C(C)(C)C |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)10(9-5-6-9)7-8-11(14)12(15)16-4/h7-11H,5-6,14H2,1-4H3/b8-7+ |
| InChIKey | ZZTDUAXXLGSLIR-BQYQJAHWSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|