C16H28N2O4 — CID 54183497
(3S)-3-amino-4-[(5-cyclopropyl-1-hydroxy-6,6-dimethylhept-3-en-2-yl)amino]-4-oxobutanoic acid (PubChem CID 54183497) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3S)-3-amino-4-[(5-cyclopropyl-1-hydroxy-6,6-dimethylhept-3-en-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[(5-cyclopropyl-1-hydroxy-6,6-dimethylhept-3-en-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54183497 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (3S)-3-amino-4-[(5-cyclopropyl-1-hydroxy-6,6-dimethylhept-3-en-2-yl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)C(C=CC(CO)NC(=O)[C@@H](N)CC(=O)O)C1CC1 |
| InChI | InChI=1S/C16H28N2O4/c1-16(2,3)12(10-4-5-10)7-6-11(9-19)18-15(22)13(17)8-14(20)21/h6-7,10-13,19H,4-5,8-9,17H2,1-3H3,(H,18,22)(H,20,21)/t11?,12?,13-/m0/s1 |
| InChIKey | PDMXUBDGGCOMFN-BPCQOVAHSA-N |
| XLogP | 0.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|