C12H16N6O6 — CID 70462600
3-amino-6-[2-[(3-amino-2,4-dioxo-1H-pyrimidin-6-yl)methoxy]ethoxymethyl]-1H-pyrimidine-2,4-dione (PubChem CID 70462600) has the molecular formula C12H16N6O6 and a molecular weight of 340.30 g/mol. Its IUPAC name is 3-amino-6-[2-[(3-amino-2,4-dioxo-1H-pyrimidin-6-yl)methoxy]ethoxymethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-amino-6-[2-[(3-amino-2,4-dioxo-1H-pyrimidin-6-yl)methoxy]ethoxymethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70462600 |
| Molecular Formula | C12H16N6O6 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-amino-6-[2-[(3-amino-2,4-dioxo-1H-pyrimidin-6-yl)methoxy]ethoxymethyl]-1H-pyrimidine-2,4-dione |
| SMILES | Nn1c(=O)cc(COCCOCc2cc(=O)n(N)c(=O)[nH]2)[nH]c1=O |
| InChI | InChI=1S/C12H16N6O6/c13-17-9(19)3-7(15-11(17)21)5-23-1-2-24-6-8-4-10(20)18(14)12(22)16-8/h3-4H,1-2,5-6,13-14H2,(H,15,21)(H,16,22) |
| InChIKey | HEAAWOARCCIZEF-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 180.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|