C15H15BrN2O5S — CID 70463386
(6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 70463386) has the molecular formula C15H15BrN2O5S and a molecular weight of 415.27 g/mol. Its IUPAC name is (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 70463386 |
| Molecular Formula | C15H15BrN2O5S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | O=C(NC1C(=O)N2CC(CBr)(C(=O)O)CS(=O)[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C15H15BrN2O5S/c16-6-15(14(21)22)7-18-12(20)10(13(18)24(23)8-15)17-11(19)9-4-2-1-3-5-9/h1-5,10,13H,6-8H2,(H,17,19)(H,21,22)/t10?,13-,15?,24?/m1/s1 |
| InChIKey | HBNPWTOUWFRSSC-RVQAREOZSA-N |
| XLogP | 0.18 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|