C18H23BrN2O5SSi — CID 70463852
trimethylsilyl (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70463852) has the molecular formula C18H23BrN2O5SSi and a molecular weight of 487.45 g/mol. Its IUPAC name is trimethylsilyl (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | trimethylsilyl (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70463852 |
| Molecular Formula | C18H23BrN2O5SSi |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | trimethylsilyl (6R)-7-benzamido-3-(bromomethyl)-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1(CBr)CN2C(=O)C(NC(=O)c3ccccc3)[C@H]2S(=O)C1 |
| InChI | InChI=1S/C18H23BrN2O5SSi/c1-28(2,3)26-17(24)18(9-19)10-21-15(23)13(16(21)27(25)11-18)20-14(22)12-7-5-4-6-8-12/h4-8,13,16H,9-11H2,1-3H3,(H,20,22)/t13?,16-,18?,27?/m1/s1 |
| InChIKey | ACTFEAAYGOJRSN-GZTWVLOHSA-N |
| XLogP | 1.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|