About 2-acetylcyclohexan-1-one;phenyl acetate
2-acetylcyclohexan-1-one;phenyl acetate (PubChem CID 70464637) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-acetylcyclohexan-1-one;phenyl acetate.
Molecular Properties
| Compound Name | 2-acetylcyclohexan-1-one;phenyl acetate |
| PubChem CID | 70464637 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-acetylcyclohexan-1-one;phenyl acetate |
| SMILES | CC(=O)C1CCCCC1=O.CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C8H12O2/c1-7(9)10-8-5-3-2-4-6-8;1-6(9)7-4-2-3-5-8(7)10/h2-6H,1H3;7H,2-5H2,1H3 |
| InChIKey | NLDLCBADXDJHCG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylcyclohexan-1-one;phenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylcyclohexan-1-one;phenyl acetate?
The IUPAC name of 2-acetylcyclohexan-1-one;phenyl acetate (CID 70464637) is 2-acetylcyclohexan-1-one;phenyl acetate.
What is the SMILES notation for 2-acetylcyclohexan-1-one;phenyl acetate?
The canonical SMILES for 2-acetylcyclohexan-1-one;phenyl acetate is CC(=O)C1CCCCC1=O.CC(=O)Oc1ccccc1.
What is the InChIKey of 2-acetylcyclohexan-1-one;phenyl acetate?
The InChIKey is NLDLCBADXDJHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C8H12O2/c1-7(9)10-8-5-3-2-4-6-8;1-6(9)7-4-2-3-5-8(7)10/h2-6H,1H3;7H,2-5H2,1H3.
What are the key properties of 2-acetylcyclohexan-1-one;phenyl acetate?
2-acetylcyclohexan-1-one;phenyl acetate has a molecular weight of 276.33 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylcyclohexan-1-one;phenyl acetate is sourced from PubChem (CID 70464637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).