C30H36ClN5O10S — CID 70465436
(4S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-4-[[3-chloro-2-(sulfoamino)benzoyl]amino]pyrrolidine-2-carboxylic acid;furan-2-ylmethanamine (PubChem CID 70465436) has the molecular formula C30H36ClN5O10S and a molecular weight of 694.16 g/mol. Its IUPAC name is (4S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-4-[[3-chloro-2-(sulfoamino)benzoyl]amino]pyrrolidine-2-carboxylic acid;furan-2-ylmethanamine.
| Compound Name | (4S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-4-[[3-chloro-2-(sulfoamino)benzoyl]amino]pyrrolidine-2-carboxylic acid;furan-2-ylmethanamine |
|---|---|
| PubChem CID | 70465436 |
| Molecular Formula | C30H36ClN5O10S |
| Molecular Weight | 694.16 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | (4S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-4-[[3-chloro-2-(sulfoamino)benzoyl]amino]pyrrolidine-2-carboxylic acid;furan-2-ylmethanamine |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1C[C@@H](NC(=O)c2cccc(Cl)c2NS(=O)(=O)O)CC1C(=O)O.NCc1ccco1 |
| InChI | InChI=1S/C25H29ClN4O9S.C5H7NO/c1-14(27-19(24(33)34)11-10-15-6-3-2-4-7-15)23(32)30-13-16(12-20(30)25(35)36)28-22(31)17-8-5-9-18(26)21(17)29-40(37,38)39;6-4-5-2-1-3-7-5/h2-9,14,16,19-20,27,29H,10-13H2,1H3,(H,28,31)(H,33,34)(H,35,36)(H,37,38,39);1-3H,4,6H2/t14-,16-,19-,20?;/m0./s1 |
| InChIKey | JWAWYKJTCOZFQG-WEEXHIRMSA-N |
| XLogP | 2.14 |
| TPSA | 241.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|