C23H26F3NO4 — CID 70466678
6-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]hex-5-enoic acid (PubChem CID 70466678) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 6-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]hex-5-enoic acid.
| Compound Name | 6-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 70466678 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 6-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]hex-5-enoic acid |
| SMILES | O=C(O)CCCC=CC1C2C=CC(C2)C1C(=O)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3NO4/c24-23(25,26)17-6-4-5-15(12-17)19(28)13-27-22(31)21-16-10-9-14(11-16)18(21)7-2-1-3-8-20(29)30/h2,4-7,9-10,12,14,16,18-19,21,28H,1,3,8,11,13H2,(H,27,31)(H,29,30) |
| InChIKey | SFWLBCBWESNOKD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|