About 2-methoxy-7H-indole
2-methoxy-7H-indole (PubChem CID 70467316) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-methoxy-7H-indole.
Molecular Properties
| Compound Name | 2-methoxy-7H-indole |
| PubChem CID | 70467316 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-methoxy-7H-indole |
| SMILES | COC1=CC2=CC=CCC2=N1 |
| InChI | InChI=1S/C9H9NO/c1-11-9-6-7-4-2-3-5-8(7)10-9/h2-4,6H,5H2,1H3 |
| InChIKey | YIVFRXWMPJFRHA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-7H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-7H-indole?
The IUPAC name of 2-methoxy-7H-indole (CID 70467316) is 2-methoxy-7H-indole.
What is the SMILES notation for 2-methoxy-7H-indole?
The canonical SMILES for 2-methoxy-7H-indole is COC1=CC2=CC=CCC2=N1.
What is the InChIKey of 2-methoxy-7H-indole?
The InChIKey is YIVFRXWMPJFRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-11-9-6-7-4-2-3-5-8(7)10-9/h2-4,6H,5H2,1H3.
What are the key properties of 2-methoxy-7H-indole?
2-methoxy-7H-indole has a molecular weight of 147.18 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-7H-indole is sourced from PubChem (CID 70467316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).